| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10017458 | HBV | ENSG00000186318.18 | protein_coding | BACE1 | No | No | 23621 | B7Z3Z4 P56817 |
| TVIS10041670 | HBV | ENSG00000186318.18 | protein_coding | BACE1 | No | No | 23621 | B7Z3Z4 P56817 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | BACE1 |
|---|---|
| DrugBank ID | DB02378 |
| Drug Name | MMI-175 |
| Target ID | BE0000988 |
| UniProt ID | P56817 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Hybrid peptides |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CC(=O)NCCCCCCOC(=O)N[C@@H](C(C)C)C(=O)N1)[C@@H](O)C[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)NCC1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL362592 |
