| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20067935 | HPV | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS20046920 | HPV | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44005456 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44024967 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44022071 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44018997 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44018998 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44018999 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44019000 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
| TVIS44019001 | HTLV-1 | ENSG00000154928.19 | protein_coding | EPHB1 | Yes | Yes | 2047 | P54762 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | EPHB1 |
|---|---|
| DrugBank ID | DB09093 |
| Drug Name | Chlortetracycline |
| Target ID | BE0009441 |
| UniProt ID | P54762 |
| Regulation Type | inhibitor |
| PubMed IDs | 33627480 |
| Citations | Ahmed MS, Wang P, Nguyen NUN, Nakada Y, Menendez-Montes I, Ismail M, Bachoo R, Henkemeyer M, Sadek HA, Kandil ES: Identification of tetracycline combinations as EphB1 tyrosine kinase inhibitors for treatment of neuropathic pain. Proc Natl Acad Sci U S A. 2021 Mar 9;118(10). pii: 2016265118. doi: 10.1073/pnas.2016265118. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Tetracyclines |
| SMILES | [H][C@@]12C[C@@]3([H])C(=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@H]2N(C)C)C(=O)C1=C(O)C=CC(Cl)=C1[C@@]3(C)O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL404520 |