| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20005075 | HPV | ENSG00000141744.4 | protein_coding | PNMT | No | No | 5409 | A8MT87 P11086 |
| TVIS20052936 | HPV | ENSG00000141744.4 | protein_coding | PNMT | No | No | 5409 | A8MT87 P11086 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PNMT |
|---|---|
| DrugBank ID | DB01752 |
| Drug Name | S-adenosyl-L-homocysteine |
| Target ID | BE0000865 |
| UniProt ID | P11086 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | 5'-deoxy-5'-thionucleosides |
| SMILES | N[C@@H](CCSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C(N)N=CN=C12)C(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL418052 |
