| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44048394 | HTLV-1 | ENSG00000101846.9 | protein_coding | STS | No | No | 412 | A6PYA4 P08842 Q0W975 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | STS |
|---|---|
| DrugBank ID | DB02292 |
| Drug Name | Irosustat |
| Target ID | BE0001197 |
| UniProt ID | P08842 |
| Regulation Type | inhibitor |
| PubMed IDs | 10910045 |
| Citations | Purohit A, Woo LW, Potter BV, Reed MJ: In vivo inhibition of estrone sulfatase activity and growth of nitrosomethylurea-induced mammary tumors by 667 COUMATE. Cancer Res. 2000 Jul 1;60(13):3394-6. |
| Groups | Investigational |
| Direct Classification | Cycloheptapyrans |
| SMILES | NS(=O)(=O)OC1=CC=C2C3=C(CCCCC3)C(=O)OC2=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL286738 |