| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047983 | HTLV-1 | ENSG00000141837.23 | protein_coding | CACNA1A | No | No | 773 | A0A087WW63 B5TYJ1 O00555 Q9NS89 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1A |
|---|---|
| DrugBank ID | DB00836 |
| Drug Name | Loperamide |
| Target ID | BE0000356 |
| UniProt ID | O00555 |
| Regulation Type | blocker |
| PubMed IDs | 17139284; 17016423; 8183255 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34.@@Church J, Fletcher EJ, Abdel-Hamid K, MacDonald JF: Loperamide blocks high-voltage-activated calcium channels and N-methyl-D-aspartate-evoked responses in rat and mouse cultured hippocampal pyramidal neurons. Mol Pharmacol. 1994 Apr;45(4):747-57. |
| Groups | Approved |
| Direct Classification | Diphenylmethanes |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(CC1)C1=CC=C(Cl)C=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | PA450262 |
| ChEMBL | CHEMBL841 |