| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10019137 | HBV | ENSG00000101966.14 | protein_coding | XIAP | Yes | No | 331 | P98170 |
| TVIS20064573 | HPV | ENSG00000101966.14 | protein_coding | XIAP | Yes | No | 331 | P98170 |
| TVIS44036721 | HTLV-1 | ENSG00000101966.14 | protein_coding | XIAP | Yes | No | 331 | P98170 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | XIAP |
|---|---|
| DrugBank ID | DB04209 |
| Drug Name | Dequalinium |
| Target ID | BE0001156 |
| UniProt ID | P98170 |
| Regulation Type | antagonist |
| PubMed IDs | 21340509 |
| Citations | Orzaez M, Gortat A, Sancho M, Carbajo RJ, Pineda-Lucena A, Palacios-Rodriguez Y, Perez-Paya E: Characterization of dequalinium as a XIAP antagonist that targets the BIR2 domain. Apoptosis. 2011 May;16(5):460-7. doi: 10.1007/s10495-011-0582-4. |
| Groups | Approved; Investigational |
| Direct Classification | 4-aminoquinolines |
| SMILES | CC1=CC(N)=C2C=CC=CC2=[N+]1CCCCCCCCCC[N+]1=C(C)C=C(N)C2=C1C=CC=C2 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL333826 |
