| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20026687 | HPV | ENSG00000068976.14 | protein_coding | PYGM | No | No | 5837 | P11217 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PYGM |
|---|---|
| DrugBank ID | DB03383 |
| Drug Name | CP-320626 |
| Target ID | BE0000916 |
| UniProt ID | P11217 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | N-acyl-alpha amino acids and derivatives |
| SMILES | OC1CCN(CC1)C(=O)[C@H](CC1=CC=C(F)C=C1)NC(=O)C1=CC2=C(N1)C=CC(Cl)=C2 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL99889 |
