Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB06712 |
| Drug Name | Nilvadipine |
| Target ID | BE0009739 |
| UniProt ID | O00305 |
| Regulation Type | blocker |
| PubMed IDs | 16398057 |
| Citations | Richard S: Vascular effects of calcium channel antagonists: new evidence. Drugs. 2005;65 Suppl 2:1-10. doi: 10.2165/00003495-200565002-00002. |
| Groups | Approved; Investigational |
| Direct Classification | Dihydropyridinecarboxylic acids and derivatives |
| SMILES | COC(=O)C1=C(NC(C)=C(C1C1=CC(=CC=C1)[N+]([O-])=O)C(=O)OC(C)C)C#N |
| Pathways | |
| PharmGKB | PA165958385 |
| ChEMBL | CHEMBL517427 |
