| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30077110 | HIV | ENSG00000175164.16 | protein_coding | ABO | No | No | 28 | A0A089QDC1 P16442 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | ABO |
|---|---|
| DrugBank ID | DB03501 |
| Drug Name | Galactose-uridine-5'-diphosphate |
| Target ID | BE0000214 |
| UniProt ID | P16442 |
| Regulation Type | |
| PubMed IDs | 12972418 |
| Citations | Nguyen HP, Seto NO, Cai Y, Leinala EK, Borisova SN, Palcic MM, Evans SV: The influence of an intramolecular hydrogen bond in differential recognition of inhibitory acceptor analogs by human ABO(H) blood group A and B glycosyltransferases. J Biol Chem. 2003 Dec 5;278(49):49191-5. Epub 2003 Sep 11. |
| Groups | Experimental |
| Direct Classification | Pyrimidine nucleotide sugars |
| SMILES | OC[C@H]1O[C@H](O[P@@](O)(=O)O[P@@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=CC(=O)NC2=O)[C@H](O)[C@@H](O)[C@H]1O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL439009 |
