| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20044451 | HPV | ENSG00000019991.18 | protein_coding | HGF | Yes | No | 3082 | P14210 |
| TVIS44015230 | HTLV-1 | ENSG00000019991.18 | protein_coding | HGF | Yes | No | 3082 | P14210 |
| TVIS44004647 | HTLV-1 | ENSG00000019991.18 | protein_coding | HGF | Yes | No | 3082 | P14210 |
| TVIS44039502 | HTLV-1 | ENSG00000019991.18 | protein_coding | HGF | Yes | No | 3082 | P14210 |
| TVIS44035497 | HTLV-1 | ENSG00000019991.18 | protein_coding | HGF | Yes | No | 3082 | P14210 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HGF |
|---|---|
| DrugBank ID | DB02264 |
| Drug Name | O2-Sulfo-Glucuronic Acid |
| Target ID | BE0001121 |
| UniProt ID | P14210 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Glucuronic acid derivatives |
| SMILES | [H][C@@]1(O)O[C@@]([H])(C(O)=O)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])OS(O)(=O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL |
