| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44014825 | HTLV-1 | ENSG00000166411.14 | protein_coding | IDH3A | No | No | 3419 | P50213 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | IDH3A |
|---|---|
| DrugBank ID | DB09092 |
| Drug Name | Xanthinol |
| Target ID | BE0000011 |
| UniProt ID | P50213 |
| Regulation Type | cofactor |
| PubMed IDs | 3936095 |
| Citations | Loriaux SM, Deijen JB, Orlebeke JF, De Swart JH: The effects of nicotinic acid and xanthinol nicotinate on human memory in different categories of age. A double blind study. Psychopharmacology (Berl). 1985;87(4):390-5. |
| Groups | Approved; Withdrawn |
| Direct Classification | Xanthines |
| SMILES | CN(CCO)CC(O)CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1624126 |