Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KCNMA1 |
|---|---|
| DrugBank ID | DB00721 |
| Drug Name | Procaine |
| Target ID | BE0004906 |
| UniProt ID | Q9UGI6 |
| Regulation Type | blocker |
| PubMed IDs | 2580269; 3179612 |
| Citations | Benham CD, Bolton TB, Lang RJ, Takewaki T: The mechanism of action of Ba2+ and TEA on single Ca2+-activated K+ -channels in arterial and intestinal smooth muscle cell membranes. Pflugers Arch. 1985 Feb;403(2):120-7.@@Ahn HY, Karaki H: Inhibitory effects of procaine on contraction and calcium movement in vascular and intestinal smooth muscles. Br J Pharmacol. 1988 Jul;94(3):789-96. doi: 10.1111/j.1476-5381.1988.tb11590.x. |
| Groups | Approved; Investigational; Vet_approved |
| Direct Classification | Benzoic acid esters |
| SMILES | CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 |
| Pathways | Procaine Action Pathway |
| PharmGKB | PA451110 |
| ChEMBL | CHEMBL569 |
