| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20068669 | HPV | ENSG00000142515.16 | protein_coding | KLK3 | No | No | 354 | P07288 Q546G3 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | KLK3 |
|---|---|
| DrugBank ID | DB04839 |
| Drug Name | Cyproterone acetate |
| Target ID | BE0008983 |
| UniProt ID | P07288 |
| Regulation Type | |
| PubMed IDs | 15308689 |
| Citations | Kang Z, Janne OA, Palvimo JJ: Coregulator recruitment and histone modifications in transcriptional regulation by the androgen receptor. Mol Endocrinol. 2004 Nov;18(11):2633-48. Epub 2004 Aug 12. |
| Groups | Approved; Investigational |
| Direct Classification | Gluco/mineralocorticoids, progestogins and derivatives |
| SMILES | [H][C@@]12C[C@]1([H])[C@@]1(C)C(=CC2=O)C(Cl)=C[C@@]2([H])[C@]3([H])CC[C@](OC(C)=O)(C(C)=O)[C@@]3(C)CC[C@]12[H] |
| Pathways | |
| PharmGKB | PA10049 |
| ChEMBL | CHEMBL139835 |