| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10025369 | HBV | ENSG00000025434.19 | protein_coding | NR1H3 | No | No | 10062 | B4DXU5 B5MBY7 F1D8N1 Q13133 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | NR1H3 |
|---|---|
| DrugBank ID | DB08063 |
| Drug Name | 1-BENZYL-3-(4-METHOXYPHENYLAMINO)-4-PHENYLPYRROLE-2,5-DIONE |
| Target ID | BE0003781 |
| UniProt ID | Q13133 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Alpha amino acids and derivatives |
| SMILES | COC1=CC=C(NC2=C(C(=O)N(CC3=CC=CC=C3)C2=O)C2=CC=CC=C2)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL189938 |
