| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44025585 | HTLV-1 | ENSG00000145675.16 | protein_coding | PIK3R1 | No | Yes | 5295 | P27986 |
| TVIS44013987 | HTLV-1 | ENSG00000145675.16 | protein_coding | PIK3R1 | No | Yes | 5295 | P27986 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PIK3R1 |
|---|---|
| DrugBank ID | DB08059 |
| Drug Name | Wortmannin |
| Target ID | BE0000955 |
| UniProt ID | P27986 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Oxasteroids and derivatives |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)C2=C3C(=CO2)C(=O)O[C@H](COC)[C@]13C |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL428496 |
