| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10018949 | HBV | ENSG00000163220.11 | protein_coding | S100A9 | No | No | 6280 | P06702 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | S100A9 |
|---|---|
| DrugBank ID | DB14487 |
| Drug Name | Zinc acetate |
| Target ID | BE0008993 |
| UniProt ID | P06702 |
| Regulation Type | |
| PubMed IDs | 17050004 |
| Citations | Vogl T, Leukert N, Barczyk K, Strupat K, Roth J: Biophysical characterization of S100A8 and S100A9 in the absence and presence of bivalent cations. Biochim Biophys Acta. 2006 Nov;1763(11):1298-306. Epub 2006 Aug 25. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | [Zn++].CC([O-])=O.CC([O-])=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1200928 |