Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB12278 |
| Drug Name | Propiverine |
| Target ID | BE0000430 |
| UniProt ID | Q13936 |
| Regulation Type | antagonist |
| PubMed IDs | 16406943 |
| Citations | Maruyama S, Oki T, Otsuka A, Shinbo H, Ozono S, Kageyama S, Mikami Y, Araki I, Takeda M, Masuyama K, Yamada S: Human muscarinic receptor binding characteristics of antimuscarinic agents to treat overactive bladder. J Urol. 2006 Jan;175(1):365-9. |
| Groups | Approved; Investigational |
| Direct Classification | Diphenylmethanes |
| SMILES | CCCOC(C(=O)OC1CCN(C)CC1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1078261 |
