| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44043387 | HTLV-1 | ENSG00000125675.20 | protein_coding | GRIA3 | No | No | 2892 | P42263 Q17R51 Q5XKG2 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | GRIA3 |
|---|---|
| DrugBank ID | DB04599 |
| Drug Name | Aniracetam |
| Target ID | BE0000831 |
| UniProt ID | P42263 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Benzoic acids and derivatives |
| SMILES | COC1=CC=C(C=C1)C(=O)N1CCCC1=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL36994 |
