| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44015543 | HTLV-1 | ENSG00000143556.9 | protein_coding | S100A7 | No | No | 6278 | P31151 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | S100A7 |
|---|---|
| DrugBank ID | DB14487 |
| Drug Name | Zinc acetate |
| Target ID | BE0003756 |
| UniProt ID | P31151 |
| Regulation Type | |
| PubMed IDs | 10026247 |
| Citations | Brodersen DE, Nyborg J, Kjeldgaard M: Zinc-binding site of an S100 protein revealed. Two crystal structures of Ca2+-bound human psoriasin (S100A7) in the Zn2+-loaded and Zn2+-free states. Biochemistry. 1999 Feb 9;38(6):1695-704. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | [Zn++].CC([O-])=O.CC([O-])=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1200928 |
