Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CACNA1C |
|---|---|
| DrugBank ID | DB00343 |
| Drug Name | Diltiazem |
| Target ID | BE0000430 |
| UniProt ID | Q13936 |
| Regulation Type | blocker |
| PubMed IDs | 10226758 |
| Citations | O'Connor SE, Grosset A, Janiak P: The pharmacological basis and pathophysiological significance of the heart rate-lowering property of diltiazem. Fundam Clin Pharmacol. 1999;13(2):145-53. |
| Groups | Approved; Investigational |
| Direct Classification | Benzothiazepines |
| SMILES | COC1=CC=C(C=C1)[C@@H]1SC2=C(C=CC=C2)N(CCN(C)C)C(=O)[C@@H]1OC(C)=O |
| Pathways | Diltiazem Action Pathway |
| PharmGKB | PA449334 |
| ChEMBL | CHEMBL23 |
