| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30004391 | HIV | ENSG00000174775.18 | protein_coding | HRAS | Yes | No | 3265 | P01112 X5D945 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRAS |
|---|---|
| DrugBank ID | DB15588 |
| Drug Name | Ursolic acid |
| Target ID | BE0001076 |
| UniProt ID | P01112 |
| Regulation Type | regulator |
| PubMed IDs | 34108504 |
| Citations | Bhaskar BV, Rammohan A, Babu TM, Zheng GY, Chen W, Rajendra W, Zyryanov GV, Gu W: Molecular insight into isoform specific inhibition of PI3K-alpha and PKC-eta with dietary agents through an ensemble pharmacophore and docking studies. Sci Rep. 2021 Jun 9;11(1):12150. doi: 10.1038/s41598-021-90287-3. |
| Groups | Experimental |
| Direct Classification | |
| SMILES | [H][C@@]12[C@@H](C)[C@H](C)CC[C@@]1(CC[C@]1(C)C2=CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL169 |
