| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30078287 | HIV | ENSG00000088926.15 | protein_coding | F11 | No | No | 2160 | P03951 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | F11 |
|---|---|
| DrugBank ID | DB07077 |
| Drug Name | (R)-1-(4-(4-(Hydroxymethyl)-1,3,2-dioxaborolan-2-YL)phenyl)guanidine |
| Target ID | BE0001021 |
| UniProt ID | P03951 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Benzene and substituted derivatives |
| SMILES | NC(N)=NC1=CC=C(C=C1)B1OC[C@@H](CO)O1 |
| Pathways | |
| PharmGKB | |
| ChEMBL |
