| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20029779 | HPV | ENSG00000113578.18 | protein_coding | FGF1 | Yes | No | 2246 | P05230 |
| TVIS20059304 | HPV | ENSG00000113578.18 | protein_coding | FGF1 | Yes | No | 2246 | P05230 |
| TVIS44031829 | HTLV-1 | ENSG00000113578.18 | protein_coding | FGF1 | Yes | No | 2246 | P05230 |
| TVIS44025448 | HTLV-1 | ENSG00000113578.18 | protein_coding | FGF1 | Yes | No | 2246 | P05230 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | FGF1 |
|---|---|
| DrugBank ID | DB03959 |
| Drug Name | N,O6-Disulfo-Glucosamine |
| Target ID | BE0000689 |
| UniProt ID | P05230 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Hexoses |
| SMILES | [H][C@]1(O)O[C@]([H])(COS(O)(=O)=O)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])NS(O)(=O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL |
