| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20045750 | HPV | ENSG00000162434.14 | protein_coding | JAK1 | Yes | Yes | 3716 | P23458 Q6P669 |
| TVIS44024604 | HTLV-1 | ENSG00000162434.14 | protein_coding | JAK1 | Yes | Yes | 3716 | P23458 Q6P669 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | JAK1 |
|---|---|
| DrugBank ID | DB12500 |
| Drug Name | Fedratinib |
| Target ID | BE0004145 |
| UniProt ID | P23458 |
| Regulation Type | inhibitor |
| PubMed IDs | 27473820 |
| Citations | Roskoski R Jr: Janus kinase (JAK) inhibitors in the treatment of inflammatory and neoplastic diseases. Pharmacol Res. 2016 Sep;111:784-803. doi: 10.1016/j.phrs.2016.07.038. Epub 2016 Jul 26. |
| Groups | Approved; Investigational |
| Direct Classification | Benzenesulfonamides |
| SMILES | CC1=CN=C(NC2=CC=C(OCCN3CCCC3)C=C2)N=C1NC1=CC=CC(=C1)S(=O)(=O)NC(C)(C)C |
| Pathways | |
| PharmGKB | PA166280361 |
| ChEMBL | CHEMBL1287853 |