| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44048888 | HTLV-1 | ENSG00000109339.24 | protein_coding | MAPK10 | No | No | 5602 | A0A286YF97 P53779 Q499Y8 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MAPK10 |
|---|---|
| DrugBank ID | DB07217 |
| Drug Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothien-2-yl)-2-fluorobenzamide |
| Target ID | BE0001097 |
| UniProt ID | P53779 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | 2-halobenzoic acids and derivatives |
| SMILES | FC1=CC=CC=C1C(=O)NC1=C(C#N)C2=C(CCCC2)S1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL234838 |
