| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44018958 | HTLV-1 | ENSG00000196639.7 | protein_coding | HRH1 | No | No | 3269 | P35367 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HRH1 |
|---|---|
| DrugBank ID | DB00215 |
| Drug Name | Citalopram |
| Target ID | BE0000442 |
| UniProt ID | P35367 |
| Regulation Type | binder |
| PubMed IDs | 17916059 |
| Citations | Bareggi SR, Mundo E, Dell'Osso B, Altamura AC: The use of escitalopram beyond major depression: pharmacological aspects, efficacy and tolerability in anxiety disorders. Expert Opin Drug Metab Toxicol. 2007 Oct;3(5):741-53. |
| Groups | Approved |
| Direct Classification | Phenylbutylamines |
| SMILES | CN(C)CCCC1(OCC2=C1C=CC(=C2)C#N)C1=CC=C(F)C=C1 |
| Pathways | Citalopram Action Pathway; Citalopram Metabolism Pathway |
| PharmGKB | PA449015 |
| ChEMBL | CHEMBL549 |
