| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44047709 | HTLV-1 | ENSG00000125686.12 | protein_coding | MED1 | No | No | 5469 | Q15648 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MED1 |
|---|---|
| DrugBank ID | DB04891 |
| Drug Name | Becocalcidiol |
| Target ID | BE0004382 |
| UniProt ID | Q15648 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Investigational |
| Direct Classification | Vitamin D and derivatives |
| SMILES | CC[C@@](C)([H])[C@@]1([H])CC[C@@]2([H])C(CCC[C@]12C)=CC=C1/C[C@](O)([H])C(=C)[C@]([H])(O)C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL2104955 |
