| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30049346 | HIV | ENSG00000105568.19 | protein_coding | PPP2R1A | No | Yes | 5518 | A8K7B7 P30153 |
| TVIS20068669 | HPV | ENSG00000105568.19 | protein_coding | PPP2R1A | No | Yes | 5518 | A8K7B7 P30153 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PPP2R1A |
|---|---|
| DrugBank ID | DB02506 |
| Drug Name | 2,6,8-Trimethyl-3-Amino-9-Benzyl-9-Methoxynonanoic Acid |
| Target ID | BE0003750 |
| UniProt ID | P30153 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Beta amino acids and derivatives |
| SMILES | [H][C@@](C)(CC[C@]([H])(N)[C@]([H])(C)C(O)=O)C[C@]([H])(C)[C@]([H])(CC1=CC=CC=C1)OC |
| Pathways | |
| PharmGKB | |
| ChEMBL |