| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44006249 | HTLV-1 | ENSG00000065675.16 | protein_coding | PRKCQ | No | No | 5588 | Q04759 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PRKCQ |
|---|---|
| DrugBank ID | DB02010 |
| Drug Name | Staurosporine |
| Target ID | BE0001385 |
| UniProt ID | Q04759 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | Indolocarbazoles |
| SMILES | [H][C@]1(C[C@@]2([H])O[C@](C)(N3C4=CC=CC=C4C4=C5CNC(=O)C5=C5C6=CC=CC=C6N2C5=C34)[C@]1([H])OC)NC |
| Pathways | |
| PharmGKB | PA165109623 |
| ChEMBL | CHEMBL388978 |
