| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44045810 | HTLV-1 | ENSG00000253729.9 | protein_coding | PRKDC | Yes | Yes | 5591 | P78527 |
| TVIS44045908 | HTLV-1 | ENSG00000253729.9 | protein_coding | PRKDC | Yes | Yes | 5591 | P78527 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PRKDC |
|---|---|
| DrugBank ID | DB00201 |
| Drug Name | Caffeine |
| Target ID | BE0002385 |
| UniProt ID | P78527 |
| Regulation Type | inhibitor |
| PubMed IDs | 12145276 |
| Citations | Foukas LC, Daniele N, Ktori C, Anderson KE, Jensen J, Shepherd PR: Direct effects of caffeine and theophylline on p110 delta and other phosphoinositide 3-kinases. Differential effects on lipid kinase and protein kinase activities. J Biol Chem. 2002 Oct 4;277(40):37124-30. Epub 2002 Jul 26. |
| Groups | Approved |
| Direct Classification | Xanthines |
| SMILES | CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Pathways | Caffeine Metabolism |
| PharmGKB | PA448710 |
| ChEMBL | CHEMBL113 |