| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44012170 | HTLV-1 | ENSG00000106799.15 | protein_coding | TGFBR1 | No | Yes | 7046 | B4DY26 P36897 Q5T7S2 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TGFBR1 |
|---|---|
| DrugBank ID | DB03921 |
| Drug Name | 4-(3-Pyridin-2-Yl-1h-Pyrazol-4-Yl)Quinoline |
| Target ID | BE0003782 |
| UniProt ID | P36897 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Quinolines and derivatives |
| SMILES | N1C=C(C(=N1)C1=NC=CC=C1)C1=C2C=CC=CC2=NC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL261454 |