| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44005816 | HTLV-1 | ENSG00000196715.7 | protein_coding | VKORC1L1 | No | No | 154807 | Q8N0U8 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | VKORC1L1 |
|---|---|
| DrugBank ID | DB00170 |
| Drug Name | Menadione |
| Target ID | BE0002329 |
| UniProt ID | Q8N0U8 |
| Regulation Type | cofactor |
| PubMed IDs | 16677080; 16102054 |
| Citations | Oldenburg J, Bevans CG, Muller CR, Watzka M: Vitamin K epoxide reductase complex subunit 1 (VKORC1): the key protein of the vitamin K cycle. Antioxid Redox Signal. 2006 Mar-Apr;8(3-4):347-53.@@Stafford DW: The vitamin K cycle. J Thromb Haemost. 2005 Aug;3(8):1873-8. |
| Groups | Approved; Nutraceutical |
| Direct Classification | Naphthoquinones |
| SMILES | CC1=CC(=O)C2=CC=CC=C2C1=O |
| Pathways | |
| PharmGKB | PA450358 |
| ChEMBL | CHEMBL590 |