| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20026712 | HPV | ENSG00000160182.3 | protein_coding | TFF1 | No | No | 7031 | P04155 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TFF1 |
|---|---|
| DrugBank ID | DB04468 |
| Drug Name | Afimoxifene |
| Target ID | BE0008981 |
| UniProt ID | P04155 |
| Regulation Type | |
| PubMed IDs | 14617632 |
| Citations | Krieg AJ, Krieg SA, Ahn BS, Shapiro DJ: Interplay between estrogen response element sequence and ligands controls in vivo binding of estrogen receptor to regulated genes. J Biol Chem. 2004 Feb 6;279(6):5025-34. Epub 2003 Nov 14. |
| Groups | Investigational |
| Direct Classification | Stilbenes |
| SMILES | CCC(=C(/C1=CC=C(O)C=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL489 |
