| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS10052636 | HBV | ENSG00000203857.10 | protein_coding | HSD3B1 | Yes | No | 3283 | P14060 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HSD3B1 |
|---|---|
| DrugBank ID | DB01536 |
| Drug Name | Androstenedione |
| Target ID | BE0000051 |
| UniProt ID | P14060 |
| Regulation Type | positive allosteric modulator |
| PubMed IDs | 2945972 |
| Citations | Ishii-Ohba H, Inano H, Tamaoki B: Purification and properties of testicular 3 beta-hydroxy-5-ene-steroid dehydrogenase and 5-ene-4-ene isomerase. J Steroid Biochem. 1986 Oct;25(4):555-60. |
| Groups | Experimental; Illicit |
| Direct Classification | Androgens and derivatives |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Pathways | Aromatase Deficiency; Androgen and Estrogen Metabolism; 17-beta Hydroxysteroid Dehydrogenase III Deficiency; Androstenedione Metabolism |
| PharmGKB | |
| ChEMBL | CHEMBL274826 |
