| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44006249 | HTLV-1 | ENSG00000065675.16 | protein_coding | PRKCQ | No | No | 5588 | Q04759 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | PRKCQ |
|---|---|
| DrugBank ID | DB04522 |
| Drug Name | Dexfosfoserine |
| Target ID | BE0001385 |
| UniProt ID | Q04759 |
| Regulation Type | |
| PubMed IDs | 17139284; 17016423 |
| Citations | Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6.@@Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. |
| Groups | Experimental |
| Direct Classification | L-alpha-amino acids |
| SMILES | N[C@@H](COP(O)(O)=O)C(O)=O |
| Pathways | Dihydropyrimidine Dehydrogenase Deficiency (DHPD); 3-Phosphoglycerate Dehydrogenase Deficiency; Glycine and Serine Metabolism; Hyperglycinemia, Non-Ketotic; Non-Ketotic Hyperglycinemia; Sarcosinemia; Dimethylglycine Dehydrogenase Deficiency |
| PharmGKB | |
| ChEMBL | CHEMBL284377 |