| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30012950 | HIV | ENSG00000099937.11 | protein_coding | SERPIND1 | No | No | 3053 | P05546 Q8IVC0 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SERPIND1 |
|---|---|
| DrugBank ID | DB14487 |
| Drug Name | Zinc acetate |
| Target ID | BE0000775 |
| UniProt ID | P05546 |
| Regulation Type | |
| PubMed IDs | 12706831 |
| Citations | Eckert R, Ragg H: Zinc ions promote the interaction between heparin and heparin cofactor II. FEBS Lett. 2003 Apr 24;541(1-3):121-5. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | [Zn++].CC([O-])=O.CC([O-])=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1200928 |
