| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44042862 | HTLV-1 | ENSG00000159228.13 | protein_coding | CBR1 | No | No | 873 | P16152 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | CBR1 |
|---|---|
| DrugBank ID | DB14635 |
| Drug Name | Curcumin sulfate |
| Target ID | BE0003074 |
| UniProt ID | P16152 |
| Regulation Type | |
| PubMed IDs | 25541467 |
| Citations | Hintzpeter J, Hornung J, Ebert B, Martin HJ, Maser E: Curcumin is a tight-binding inhibitor of the most efficient human daunorubicin reductase--Carbonyl reductase 1. Chem Biol Interact. 2015 Jun 5;234:162-8. doi: 10.1016/j.cbi.2014.12.019. Epub 2014 Dec 22. |
| Groups | Experimental |
| Direct Classification | Curcuminoids |
| SMILES | COC1=CC(C=CC(=O)CC(=O)C=CC2=CC=C(OS(O)(=O)=O)C(OC)=C2)=CC=C1O |
| Pathways | |
| PharmGKB | |
| ChEMBL |
