| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS43000120 | MCV | ENSG00000171552.14 | protein_coding | BCL2L1 | No | No | 598 | A0A0S2Z3C5 Q07817 Q5TE63 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | BCL2L1 |
|---|---|
| DrugBank ID | DB07108 |
| Drug Name | 4'-FLUORO-1,1'-BIPHENYL-4-CARBOXYLIC ACID |
| Target ID | BE0003510 |
| UniProt ID | Q07817 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Biphenyls and derivatives |
| SMILES | OC(=O)C1=CC=C(C=C1)C1=CC=C(F)C=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL106708 |