| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44046727 | HTLV-1 | ENSG00000204370.14 | protein_coding | SDHD | No | Yes | 6392 | A0A0S2Z4H7 A0A0S2Z4J3 O14521 |
| TVIS44046726 | HTLV-1 | ENSG00000204370.14 | protein_coding | SDHD | No | Yes | 6392 | A0A0S2Z4H7 A0A0S2Z4J3 O14521 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SDHD |
|---|---|
| DrugBank ID | DB00756 |
| Drug Name | Hexachlorophene |
| Target ID | BE0002252 |
| UniProt ID | O14521 |
| Regulation Type | inhibitor |
| PubMed IDs | 10487417 |
| Citations | Lokanatha V, Sailaja P, Rajendra W: In vitro kinetics of the rat brain succinate dehydrogenase inhibition by hexachlorophene. J Biochem Mol Toxicol. 1999;13(6):303-6. |
| Groups | Approved; Withdrawn |
| Direct Classification | Diphenylmethanes |
| SMILES | OC1=C(CC2=C(O)C(Cl)=CC(Cl)=C2Cl)C(Cl)=C(Cl)C=C1Cl |
| Pathways | |
| PharmGKB | PA449871 |
| ChEMBL | CHEMBL496 |
