| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44046727 | HTLV-1 | ENSG00000204370.14 | protein_coding | SDHD | No | Yes | 6392 | A0A0S2Z4H7 A0A0S2Z4J3 O14521 |
| TVIS44046726 | HTLV-1 | ENSG00000204370.14 | protein_coding | SDHD | No | Yes | 6392 | A0A0S2Z4H7 A0A0S2Z4J3 O14521 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SDHD |
|---|---|
| DrugBank ID | DB04141 |
| Drug Name | 2-Hexyloxy-6-Hydroxymethyl-Tetrahydro-Pyran-3,4,5-Triol |
| Target ID | BE0002252 |
| UniProt ID | O14521 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Fatty acyl glycosides of mono- and disaccharides |
| SMILES | [H][C@]1(O)[C@@]([H])(O)[C@@]([H])(CO)O[C@@]([H])(OCCCCCC)[C@]1([H])O |
| Pathways | |
| PharmGKB | |
| ChEMBL |