| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20049492 | HPV | ENSG00000149452.16 | protein_coding | SLC22A8 | No | No | 9376 | Q8TCC7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC22A8 |
|---|---|
| DrugBank ID | DB00493 |
| Drug Name | Cefotaxime |
| Target ID | BE0003645 |
| UniProt ID | Q8TCC7 |
| Regulation Type | |
| PubMed IDs | 11909604 |
| Citations | Takeda M, Babu E, Narikawa S, Endou H: Interaction of human organic anion transporters with various cephalosporin antibiotics. Eur J Pharmacol. 2002 Mar 8;438(3):137-42. |
| Groups | Approved |
| Direct Classification | Cephalosporin 3'-esters |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)C(=N/OC)C1=CSC(N)=N1)C(O)=O |
| Pathways | |
| PharmGKB | PA448852 |
| ChEMBL | CHEMBL1730 |
