| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20049492 | HPV | ENSG00000149452.16 | protein_coding | SLC22A8 | No | No | 9376 | Q8TCC7 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | SLC22A8 |
|---|---|
| DrugBank ID | DB01053 |
| Drug Name | Benzylpenicillin |
| Target ID | BE0003645 |
| UniProt ID | Q8TCC7 |
| Regulation Type | substrate |
| PubMed IDs | 12130730 |
| Citations | Takeda M, Khamdang S, Narikawa S, Kimura H, Hosoyamada M, Cha SH, Sekine T, Endou H: Characterization of methotrexate transport and its drug interactions with human organic anion transporters. J Pharmacol Exp Ther. 2002 Aug;302(2):666-71. |
| Groups | Approved; Vet_approved |
| Direct Classification | Dipeptides |
| SMILES | [H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)CC1=CC=CC=C1)C(O)=O |
| Pathways | |
| PharmGKB | PA450842 |
| ChEMBL | CHEMBL29 |
