| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30085360 | HIV | ENSG00000057593.14 | protein_coding | F7 | No | No | 2155 | F5H8B0 P08709 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | F7 |
|---|---|
| DrugBank ID | DB07247 |
| Drug Name | [2'-HYDROXY-3'-(1H-PYRROLO[3,2-C]PYRIDIN-2-YL)-BIPHENYL-3-YLMETHYL]-UREA |
| Target ID | BE0000333 |
| UniProt ID | P08709 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Biphenyls and derivatives |
| SMILES | NC(=O)NCC1=CC(=CC=C1)C1=C(O)C(=CC=C1)C1=CC2=C(N1)C=CN=C2 |
| Pathways | |
| PharmGKB | |
| ChEMBL |
