No data available for the specified gene.
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | HDAC1 |
|---|---|
| DrugBank ID | DB06176 |
| Drug Name | Romidepsin |
| Target ID | BE0008667 |
| UniProt ID | Q9UKV0 |
| Regulation Type | inhibitor |
| PubMed IDs | 12678732 |
| Citations | Kouraklis G, Theocharis S: Histone deacetylase inhibitors and anticancer therapy. Curr Med Chem Anticancer Agents. 2002 Jul;2(4):477-84. doi: 10.2174/1568011023353921. |
| Groups | Approved; Investigational |
| Direct Classification | |
| SMILES | CC=C1/NC(=O)[C@H]2CSSCCC=C[C@H](CC(=O)N[C@H](C(C)C)C(=O)N2)OC(=O)[C@@H](NC1=O)C(C)C |
| Pathways | |
| PharmGKB | PA166161306 |
| ChEMBL | CHEMBL343448 |
