| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30018466 | HIV | ENSG00000087586.18 | protein_coding | AURKA | Yes | No | 6790 | O14965 |
| TVIS30053969 | HIV | ENSG00000087586.18 | protein_coding | AURKA | Yes | No | 6790 | O14965 |
| TVIS44033120 | HTLV-1 | ENSG00000087586.18 | protein_coding | AURKA | Yes | No | 6790 | O14965 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | AURKA |
|---|---|
| DrugBank ID | DB07801 |
| Drug Name | N-butyl-3-{[6-(9H-purin-6-ylamino)hexanoyl]amino}benzamide |
| Target ID | BE0000991 |
| UniProt ID | O14965 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Acylaminobenzoic acid and derivatives |
| SMILES | CCCCNC(=O)C1=CC=CC(NC(=O)CCCCCNC2=C3N=CNC3=NC=N2)=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL521105 |
