| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20039353 | HPV | ENSG00000145863.11 | protein_coding | GABRA6 | Yes | No | 2559 | Q16445 |
| TVIS44015037 | HTLV-1 | ENSG00000145863.11 | protein_coding | GABRA6 | Yes | No | 2559 | Q16445 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | GABRA6 |
|---|---|
| DrugBank ID | DB01353 |
| Drug Name | Butobarbital |
| Target ID | BE0000764 |
| UniProt ID | Q16445 |
| Regulation Type | potentiator |
| PubMed IDs | 10209232; 11264449 |
| Citations | Mehta AK, Ticku MK: An update on GABAA receptors. Brain Res Brain Res Rev. 1999 Apr;29(2-3):196-217.@@Yamakura T, Bertaccini E, Trudell JR, Harris RA: Anesthetics and ion channels: molecular models and sites of action. Annu Rev Pharmacol Toxicol. 2001;41:23-51. |
| Groups | Approved; Illicit |
| Direct Classification | Barbituric acid derivatives |
| SMILES | CCCCC1(CC)C(=O)NC(=O)NC1=O |
| Pathways | |
| PharmGKB | PA164748035 |
| ChEMBL | CHEMBL404422 |