| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30053672 | HIV | ENSG00000198900.7 | protein_coding | TOP1 | Yes | No | 7150 | P11387 |
| TVIS20018930 | HPV | ENSG00000198900.7 | protein_coding | TOP1 | Yes | No | 7150 | P11387 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | TOP1 |
|---|---|
| DrugBank ID | DB08159 |
| Drug Name | 4-(5,11-DIOXO-5H-INDENO[1,2-C]ISOQUINOLIN-6(11H)-YL)BUTANOATE |
| Target ID | BE0000971 |
| UniProt ID | P11387 |
| Regulation Type | |
| PubMed IDs | 10592235 |
| Citations | Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. |
| Groups | Experimental |
| Direct Classification | Isoquinolones and derivatives |
| SMILES | OC(=O)CCCN1C2=C(C(=O)C3=CC=CC=C23)C2=CC=CC=C2C1=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL343336 |
