| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS44046321 | HTLV-1 | ENSG00000066468.24 | protein_coding | FGFR2 | Yes | No | 2263 | A0A141AXF1 D2CGD1 P21802 S4R381 |
| TVIS44046546 | HTLV-1 | ENSG00000066468.24 | protein_coding | FGFR2 | Yes | No | 2263 | A0A141AXF1 D2CGD1 P21802 S4R381 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | FGFR2 |
|---|---|
| DrugBank ID | DB01901 |
| Drug Name | Sucrosofate |
| Target ID | BE0000748 |
| UniProt ID | P21802 |
| Regulation Type | ligand |
| PubMed IDs | 15047176 |
| Citations | Hung KW, Kumar TK, Chi YH, Chiu IM, Yu C: Molecular cloning, overexpression, and characterization of the ligand-binding D2 domain of fibroblast growth factor receptor. Biochem Biophys Res Commun. 2004 Apr 23;317(1):253-8. |
| Groups | Experimental |
| Direct Classification | Disaccharide sulfates |
| SMILES | OS(=O)(=O)OC[C@H]1O[C@@](COS(O)(=O)=O)(O[C@H]2O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]2OS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@@H]1OS(O)(=O)=O |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL1235872 |
