| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS30004337 | HIV | ENSG00000117400.18 | protein_coding | MPL | Yes | No | 4352 | P40238 |
| TVIS30023463 | HIV | ENSG00000117400.18 | protein_coding | MPL | Yes | No | 4352 | P40238 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MPL |
|---|---|
| DrugBank ID | DB06210 |
| Drug Name | Eltrombopag |
| Target ID | BE0003440 |
| UniProt ID | P40238 |
| Regulation Type | agonist |
| PubMed IDs | 19642221 |
| Citations | Kuter DJ: Thrombopoietin and thrombopoietin mimetics in the treatment of thrombocytopenia. Annu Rev Med. 2009;60:193-206. |
| Groups | Approved |
| Direct Classification | Biphenyls and derivatives |
| SMILES | CC1=NN(C(=O)C1=N/NC1=CC=CC(C2=CC=CC(=C2)C(O)=O)=C1O)C1=CC=C(C)C(C)=C1 |
| Pathways | |
| PharmGKB | |
| ChEMBL | CHEMBL461101 |
