| VIS ID | Virus | Ensembl ID | Gene Type | Target Gene | Oncogene | Tumor Suppressor Gene | NCBI ID | Uniprot ID |
|---|---|---|---|---|---|---|---|---|
| TVIS20011855 | HPV | ENSG00000134640.3 | protein_coding | MTNR1B | No | No | 4544 | P49286 |
Target Gene Table
▼
TCGA Plot Options
▼
Drug Information
▼
| Gene | MTNR1B |
|---|---|
| DrugBank ID | DB02709 |
| Drug Name | Resveratrol |
| Target ID | BE0000327 |
| UniProt ID | P49286 |
| Regulation Type | |
| PubMed IDs | 20399199 |
| Citations | Ferry G, Hecht S, Berger S, Moulharat N, Coge F, Guillaumet G, Leclerc V, Yous S, Delagrange P, Boutin JA: Old and new inhibitors of quinone reductase 2. Chem Biol Interact. 2010 Jul 30;186(2):103-9. doi: 10.1016/j.cbi.2010.04.006. Epub 2010 May 4. |
| Groups | Investigational |
| Direct Classification | Stilbenes |
| SMILES | OC1=CC=C(C=CC2=CC(O)=CC(O)=C2)C=C1 |
| Pathways | |
| PharmGKB | PA165291838 |
| ChEMBL | CHEMBL165 |